C24H28O4 — CID 24878732
5-hydroxy-2-phenyl-6,8,8-tripropylchromene-4,7-dione (PubChem CID 24878732) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 5-hydroxy-2-phenyl-6,8,8-tripropylchromene-4,7-dione.
| Compound Name | 5-hydroxy-2-phenyl-6,8,8-tripropylchromene-4,7-dione |
|---|---|
| PubChem CID | 24878732 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-hydroxy-2-phenyl-6,8,8-tripropylchromene-4,7-dione |
| SMILES | CCCC1=C(O)c2c(oc(-c3ccccc3)cc2=O)C(CCC)(CCC)C1=O |
| InChI | InChI=1S/C24H28O4/c1-4-10-17-21(26)20-18(25)15-19(16-11-8-7-9-12-16)28-23(20)24(13-5-2,14-6-3)22(17)27/h7-9,11-12,15,26H,4-6,10,13-14H2,1-3H3 |
| InChIKey | RQLCBGXYBQYVPQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |