C22H18O4 — CID 24878784
5-hydroxy-6,8,8-trimethyl-2-naphthalen-1-ylchromene-4,7-dione (PubChem CID 24878784) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-hydroxy-6,8,8-trimethyl-2-naphthalen-1-ylchromene-4,7-dione.
| Compound Name | 5-hydroxy-6,8,8-trimethyl-2-naphthalen-1-ylchromene-4,7-dione |
|---|---|
| PubChem CID | 24878784 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-hydroxy-6,8,8-trimethyl-2-naphthalen-1-ylchromene-4,7-dione |
| SMILES | CC1=C(O)c2c(oc(-c3cccc4ccccc34)cc2=O)C(C)(C)C1=O |
| InChI | InChI=1S/C22H18O4/c1-12-19(24)18-16(23)11-17(26-21(18)22(2,3)20(12)25)15-10-6-8-13-7-4-5-9-14(13)15/h4-11,24H,1-3H3 |
| InChIKey | JVUIYCWTZMLAIP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |