C12H20O8 — CID 24879104
(2R,3R,4S,5S,6R)-2-[(1R,4S,6S)-4,6-dihydroxycyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 24879104) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(1R,4S,6S)-4,6-dihydroxycyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(1R,4S,6S)-4,6-dihydroxycyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 24879104 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1R,4S,6S)-4,6-dihydroxycyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2C=C[C@@H](O)C[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O8/c13-4-8-9(16)10(17)11(18)12(20-8)19-7-2-1-5(14)3-6(7)15/h1-2,5-18H,3-4H2/t5-,6+,7-,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | FSZLXNSBZLJIOC-VIXLETMSSA-N |
| XLogP | -3.15 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|