About 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate
2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 24879132) has the molecular formula C23H16N4O5
and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 24879132 |
| Molecular Formula | C23H16N4O5 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | NC1=CC(=O)c2ccc(-c3nc(C(=O)OCCO)cc4c3[nH]c3ccccc34)nc2C1=O |
| InChI | InChI=1S/C23H16N4O5/c24-14-10-18(29)12-5-6-16(26-20(12)22(14)30)21-19-13(11-3-1-2-4-15(11)25-19)9-17(27-21)23(31)32-8-7-28/h1-6,9-10,25,28H,7-8,24H2 |
| InChIKey | CZOSRJQATJYCOK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate (CID 24879132) is 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate is NC1=CC(=O)c2ccc(-c3nc(C(=O)OCCO)cc4c3[nH]c3ccccc34)nc2C1=O.
What is the InChIKey of 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is CZOSRJQATJYCOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O5/c24-14-10-18(29)12-5-6-16(26-20(12)22(14)30)21-19-13(11-3-1-2-4-15(11)25-19)9-17(27-21)23(31)32-8-7-28/h1-6,9-10,25,28H,7-8,24H2.
What are the key properties of 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate?
2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 428.40 g/mol, XLogP of 2.15, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 24879132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).