About 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine
6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine (PubChem CID 24879140) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
| PubChem CID | 24879140 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
| SMILES | COc1cc(Nc2cncc(-c3ccncc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N4O3/c1-23-15-8-13(9-16(24-2)18(15)25-3)21-17-11-20-10-14(22-17)12-4-6-19-7-5-12/h4-11H,1-3H3,(H,21,22) |
| InChIKey | KEXLNILEKWXMDI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine?
The IUPAC name of 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine (CID 24879140) is 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine.
What is the SMILES notation for 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine?
The canonical SMILES for 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine is COc1cc(Nc2cncc(-c3ccncc3)n2)cc(OC)c1OC.
What is the InChIKey of 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine?
The InChIKey is KEXLNILEKWXMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-23-15-8-13(9-16(24-2)18(15)25-3)21-17-11-20-10-14(22-17)12-4-6-19-7-5-12/h4-11H,1-3H3,(H,21,22).
What are the key properties of 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine?
6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine has a molecular weight of 338.37 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyridin-4-yl-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine is sourced from PubChem (CID 24879140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).