About [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone
[2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone (PubChem CID 24879211) has the molecular formula C25H21NO5
and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone |
| PubChem CID | 24879211 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(Oc2ccnc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C25H21NO5/c1-28-17-9-10-18(25(27)16-7-5-4-6-8-16)22(13-17)31-21-11-12-26-20-15-24(30-3)23(29-2)14-19(20)21/h4-15H,1-3H3 |
| InChIKey | LFKMHOUNFWFTTF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone?
The IUPAC name of [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone (CID 24879211) is [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone.
What is the SMILES notation for [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone?
The canonical SMILES for [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone is COc1ccc(C(=O)c2ccccc2)c(Oc2ccnc3cc(OC)c(OC)cc23)c1.
What is the InChIKey of [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone?
The InChIKey is LFKMHOUNFWFTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO5/c1-28-17-9-10-18(25(27)16-7-5-4-6-8-16)22(13-17)31-21-11-12-26-20-15-24(30-3)23(29-2)14-19(20)21/h4-15H,1-3H3.
What are the key properties of [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone?
[2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone has a molecular weight of 415.45 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,7-dimethoxyquinolin-4-yl)oxy-4-methoxyphenyl]-phenylmethanone is sourced from PubChem (CID 24879211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).