About N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide
N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide (PubChem CID 24879265) has the molecular formula C25H24N4O5
and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide |
| PubChem CID | 24879265 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide |
| SMILES | COc1cc(Nc2cncc(Oc3cccc4c(NC(C)=O)cccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O5/c1-15(30)27-19-9-5-8-18-17(19)7-6-10-20(18)34-24-14-26-13-23(29-24)28-16-11-21(31-2)25(33-4)22(12-16)32-3/h5-14H,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | CTSAUJDHCRYHOQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide?
The IUPAC name of N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide (CID 24879265) is N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide.
What is the SMILES notation for N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide?
The canonical SMILES for N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide is COc1cc(Nc2cncc(Oc3cccc4c(NC(C)=O)cccc34)n2)cc(OC)c1OC.
What is the InChIKey of N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide?
The InChIKey is CTSAUJDHCRYHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O5/c1-15(30)27-19-9-5-8-18-17(19)7-6-10-20(18)34-24-14-26-13-23(29-24)28-16-11-21(31-2)25(33-4)22(12-16)32-3/h5-14H,1-4H3,(H,27,30)(H,28,29).
What are the key properties of N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide?
N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide has a molecular weight of 460.49 g/mol, XLogP of 5.15, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[6-(3,4,5-trimethoxyanilino)pyrazin-2-yl]oxynaphthalen-1-yl]acetamide is sourced from PubChem (CID 24879265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).