C18H19N5O3 — CID 24879390
6-N-pyridin-4-yl-2-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine (PubChem CID 24879390) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 6-N-pyridin-4-yl-2-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine.
| Compound Name | 6-N-pyridin-4-yl-2-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 24879390 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 6-N-pyridin-4-yl-2-N-(3,4,5-trimethoxyphenyl)pyrazine-2,6-diamine |
| SMILES | COc1cc(Nc2cncc(Nc3ccncc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N5O3/c1-24-14-8-13(9-15(25-2)18(14)26-3)22-17-11-20-10-16(23-17)21-12-4-6-19-7-5-12/h4-11H,1-3H3,(H2,19,21,22,23) |
| InChIKey | FWUVOKGKHMWHSU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |