C23H44O7Si2 — CID 24879811
methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 24879811) has the molecular formula C23H44O7Si2 and a molecular weight of 488.77 g/mol. Its IUPAC name is methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 24879811 |
| Molecular Formula | C23H44O7Si2 |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C23H44O7Si2/c1-22(2,3)31(8,9)29-19-18-16(13-12-15(27-18)14-17(24)26-7)28-21(25)20(19)30-32(10,11)23(4,5)6/h15-16,18-20H,12-14H2,1-11H3/t15-,16+,18+,19+,20+/m1/s1 |
| InChIKey | ZYTXWJNKGSPJKH-JVJLKXRTSA-N |
| XLogP | 4.80 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|