C19H36O6Si — CID 24879906
methyl 2-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-[(2S)-1-oxopropan-2-yl]oxan-2-yl]acetate (PubChem CID 24879906) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-[(2S)-1-oxopropan-2-yl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-[(2S)-1-oxopropan-2-yl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 24879906 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | methyl 2-[(2S,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-methyl-6-[(2S)-1-oxopropan-2-yl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C(C)C=O)O1 |
| InChI | InChI=1S/C19H36O6Si/c1-13(12-20)17-14(2)15(25-26(8,9)18(3,4)5)10-19(23-7,24-17)11-16(21)22-6/h12-15,17H,10-11H2,1-9H3/t13?,14-,15+,17+,19+/m1/s1 |
| InChIKey | WCUIOQGGEOSFKD-LQRLCEIKSA-N |
| XLogP | 3.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|