About 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole
1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole (PubChem CID 24880291) has the molecular formula C6H4F6N2O
and a molecular weight of 234.10 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole.
Molecular Properties
| Compound Name | 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole |
| PubChem CID | 24880291 |
| Molecular Formula | C6H4F6N2O |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole |
| SMILES | FC(OC(F)(F)F)C(F)(F)n1ccnc1 |
| InChI | InChI=1S/C6H4F6N2O/c7-4(15-6(10,11)12)5(8,9)14-2-1-13-3-14/h1-4H |
| InChIKey | TYBWWMPZQKTXSM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole?
The IUPAC name of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole (CID 24880291) is 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole.
What is the SMILES notation for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole?
The canonical SMILES for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole is FC(OC(F)(F)F)C(F)(F)n1ccnc1.
What is the InChIKey of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole?
The InChIKey is TYBWWMPZQKTXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F6N2O/c7-4(15-6(10,11)12)5(8,9)14-2-1-13-3-14/h1-4H.
What are the key properties of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole?
1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole has a molecular weight of 234.10 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]imidazole is sourced from PubChem (CID 24880291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).