C7H5F6N — CID 24880292
1-(1,1,2,3,3,3-hexafluoropropyl)pyrrole (PubChem CID 24880292) has the molecular formula C7H5F6N and a molecular weight of 217.11 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)pyrrole.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)pyrrole |
|---|---|
| PubChem CID | 24880292 |
| Molecular Formula | C7H5F6N |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)pyrrole |
| SMILES | FC(C(F)(F)F)C(F)(F)n1cccc1 |
| InChI | InChI=1S/C7H5F6N/c8-5(6(9,10)11)7(12,13)14-3-1-2-4-14/h1-5H |
| InChIKey | MJYVASYHNINIGW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |