About 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole
1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole (PubChem CID 24880354) has the molecular formula C5H3F6N3O
and a molecular weight of 235.09 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole.
Molecular Properties
| Compound Name | 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole |
| PubChem CID | 24880354 |
| Molecular Formula | C5H3F6N3O |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole |
| SMILES | FC(OC(F)(F)F)C(F)(F)n1ccnn1 |
| InChI | InChI=1S/C5H3F6N3O/c6-3(15-5(9,10)11)4(7,8)14-2-1-12-13-14/h1-3H |
| InChIKey | LRMVIBAJUMRCMD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole?
The IUPAC name of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole (CID 24880354) is 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole.
What is the SMILES notation for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole?
The canonical SMILES for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole is FC(OC(F)(F)F)C(F)(F)n1ccnn1.
What is the InChIKey of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole?
The InChIKey is LRMVIBAJUMRCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F6N3O/c6-3(15-5(9,10)11)4(7,8)14-2-1-12-13-14/h1-3H.
What are the key properties of 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole?
1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole has a molecular weight of 235.09 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1,2-trifluoro-2-(trifluoromethoxy)ethyl]triazole is sourced from PubChem (CID 24880354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).