C5H3F6N3 — CID 24880356
1-(1,1,2,3,3,3-hexafluoropropyl)-1,2,4-triazole (PubChem CID 24880356) has the molecular formula C5H3F6N3 and a molecular weight of 219.09 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)-1,2,4-triazole.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 24880356 |
| Molecular Formula | C5H3F6N3 |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-1,2,4-triazole |
| SMILES | FC(C(F)(F)F)C(F)(F)n1cncn1 |
| InChI | InChI=1S/C5H3F6N3/c6-3(4(7,8)9)5(10,11)14-2-12-1-13-14/h1-3H |
| InChIKey | OSWSOTFXFCBUIV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |