C28H27F2N3O5 — CID 24880413
3-[1,1-difluoro-2-[4-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide (PubChem CID 24880413) has the molecular formula C28H27F2N3O5 and a molecular weight of 523.54 g/mol. Its IUPAC name is 3-[1,1-difluoro-2-[4-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide.
| Compound Name | 3-[1,1-difluoro-2-[4-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 24880413 |
| Molecular Formula | C28H27F2N3O5 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 3-[1,1-difluoro-2-[4-[2-[[2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide |
| SMILES | NC(=O)c1cccc(C(F)(F)COc2ccc(CCNCC(O)c3ccc(O)c4[nH]c(=O)ccc34)cc2)c1 |
| InChI | InChI=1S/C28H27F2N3O5/c29-28(30,19-3-1-2-18(14-19)27(31)37)16-38-20-6-4-17(5-7-20)12-13-32-15-24(35)21-8-10-23(34)26-22(21)9-11-25(36)33-26/h1-11,14,24,32,34-35H,12-13,15-16H2,(H2,31,37)(H,33,36) |
| InChIKey | XRDHGXHLSKWAMH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|