C24H22Cl3N3O2 — CID 24880775
5-(4-chlorophenyl)-N-(cyclohexanecarbonyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 24880775) has the molecular formula C24H22Cl3N3O2 and a molecular weight of 490.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(cyclohexanecarbonyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(cyclohexanecarbonyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24880775 |
| Molecular Formula | C24H22Cl3N3O2 |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(cyclohexanecarbonyl)-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC(=O)C2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22Cl3N3O2/c1-14-21(24(32)28-23(31)16-5-3-2-4-6-16)29-30(20-12-11-18(26)13-19(20)27)22(14)15-7-9-17(25)10-8-15/h7-13,16H,2-6H2,1H3,(H,28,31,32) |
| InChIKey | KZPLHBOSKMQZGZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|