About 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide (PubChem CID 24880839) has the molecular formula C23H22Cl3N3O2
and a molecular weight of 478.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide |
| PubChem CID | 24880839 |
| Molecular Formula | C23H22Cl3N3O2 |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide |
| SMILES | CCCCCC(=O)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C23H22Cl3N3O2/c1-3-4-5-6-20(30)27-23(31)21-14(2)22(15-7-9-16(24)10-8-15)29(28-21)19-12-11-17(25)13-18(19)26/h7-13H,3-6H2,1-2H3,(H,27,30,31) |
| InChIKey | YXYBTDLDZVTMMN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide (CID 24880839) is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide is CCCCCC(=O)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C.
What is the InChIKey of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide?
The InChIKey is YXYBTDLDZVTMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl3N3O2/c1-3-4-5-6-20(30)27-23(31)21-14(2)22(15-7-9-16(24)10-8-15)29(28-21)19-12-11-17(25)13-18(19)26/h7-13H,3-6H2,1-2H3,(H,27,30,31).
What are the key properties of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide?
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide has a molecular weight of 478.81 g/mol, XLogP of 6.64, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-N-hexanoyl-4-methylpyrazole-3-carboxamide is sourced from PubChem (CID 24880839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).