C21H21NO7S — CID 24881227
ethyl 2-[4,5-bis(4-methoxyphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]acetate (PubChem CID 24881227) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is ethyl 2-[4,5-bis(4-methoxyphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]acetate.
| Compound Name | ethyl 2-[4,5-bis(4-methoxyphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 24881227 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl 2-[4,5-bis(4-methoxyphenyl)-1,1,3-trioxo-1,2-thiazol-2-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(c2ccc(OC)cc2)=C(c2ccc(OC)cc2)S1(=O)=O |
| InChI | InChI=1S/C21H21NO7S/c1-4-29-18(23)13-22-21(24)19(14-5-9-16(27-2)10-6-14)20(30(22,25)26)15-7-11-17(28-3)12-8-15/h5-12H,4,13H2,1-3H3 |
| InChIKey | NLTWFRANSWJKKK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|