About 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole (PubChem CID 24881242) has the molecular formula C27H24N2S
and a molecular weight of 408.57 g/mol. Its IUPAC name is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole.
Molecular Properties
| Compound Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole |
| PubChem CID | 24881242 |
| Molecular Formula | C27H24N2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole |
| SMILES | Cn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21 |
| InChI | InChI=1S/C27H24N2S/c1-27(2)16-17-30-25-15-12-20(18-22(25)27)9-8-19-10-13-21(14-11-19)26-28-23-6-4-5-7-24(23)29(26)3/h4-7,10-15,18H,16-17H2,1-3H3 |
| InChIKey | CUTKQWJOCHTMET-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole?
The IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole (CID 24881242) is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole.
What is the SMILES notation for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole?
The canonical SMILES for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole is Cn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21.
What is the InChIKey of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole?
The InChIKey is CUTKQWJOCHTMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2S/c1-27(2)16-17-30-25-15-12-20(18-22(25)27)9-8-19-10-13-21(14-11-19)26-28-23-6-4-5-7-24(23)29(26)3/h4-7,10-15,18H,16-17H2,1-3H3.
What are the key properties of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole?
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole has a molecular weight of 408.57 g/mol, XLogP of 6.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-methylbenzimidazole is sourced from PubChem (CID 24881242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).