About 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole (PubChem CID 24881243) has the molecular formula C29H28N2S
and a molecular weight of 436.62 g/mol. Its IUPAC name is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole.
Molecular Properties
| Compound Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole |
| PubChem CID | 24881243 |
| Molecular Formula | C29H28N2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole |
| SMILES | CCCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21 |
| InChI | InChI=1S/C29H28N2S/c1-4-18-31-26-8-6-5-7-25(26)30-28(31)23-14-11-21(12-15-23)9-10-22-13-16-27-24(20-22)29(2,3)17-19-32-27/h5-8,11-16,20H,4,17-19H2,1-3H3 |
| InChIKey | SXQHKLQRXGNALN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole?
The IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole (CID 24881243) is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole.
What is the SMILES notation for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole?
The canonical SMILES for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole is CCCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21.
What is the InChIKey of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole?
The InChIKey is SXQHKLQRXGNALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28N2S/c1-4-18-31-26-8-6-5-7-25(26)30-28(31)23-14-11-21(12-15-23)9-10-22-13-16-27-24(20-22)29(2,3)17-19-32-27/h5-8,11-16,20H,4,17-19H2,1-3H3.
What are the key properties of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole?
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole has a molecular weight of 436.62 g/mol, XLogP of 7.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-propylbenzimidazole is sourced from PubChem (CID 24881243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).