About N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide
N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide (PubChem CID 24881407) has the molecular formula C23H27N5O3
and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
| PubChem CID | 24881407 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(-c2cnnn2Cc2ccccc2)cc1)NO |
| InChI | InChI=1S/C23H27N5O3/c29-22(10-6-1-2-7-11-23(30)26-31)25-20-14-12-19(13-15-20)21-16-24-27-28(21)17-18-8-4-3-5-9-18/h3-5,8-9,12-16,31H,1-2,6-7,10-11,17H2,(H,25,29)(H,26,30) |
| InChIKey | KNYJYVXHDVYGRE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The IUPAC name of N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide (CID 24881407) is N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide is O=C(CCCCCCC(=O)Nc1ccc(-c2cnnn2Cc2ccccc2)cc1)NO.
What is the InChIKey of N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The InChIKey is KNYJYVXHDVYGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N5O3/c29-22(10-6-1-2-7-11-23(30)26-31)25-20-14-12-19(13-15-20)21-16-24-27-28(21)17-18-8-4-3-5-9-18/h3-5,8-9,12-16,31H,1-2,6-7,10-11,17H2,(H,25,29)(H,26,30).
What are the key properties of N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide has a molecular weight of 421.50 g/mol, XLogP of 3.78, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-benzyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide is sourced from PubChem (CID 24881407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).