C29H41F3O6SSi — CID 24881489
[(2S)-2-[(4R,5S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] trifluoromethanesulfonate (PubChem CID 24881489) has the molecular formula C29H41F3O6SSi and a molecular weight of 602.79 g/mol. Its IUPAC name is [(2S)-2-[(4R,5S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] trifluoromethanesulfonate.
| Compound Name | [(2S)-2-[(4R,5S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24881489 |
| Molecular Formula | C29H41F3O6SSi |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [(2S)-2-[(4R,5S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1[C@@H]([C@@H](C)COS(=O)(=O)C(F)(F)F)OC(C)(C)O[C@H]1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41F3O6SSi/c1-21(20-35-39(33,34)29(30,31)32)26-22(2)25(37-28(6,7)38-26)18-19-36-40(27(3,4)5,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,21-22,25-26H,18-20H2,1-7H3/t21-,22-,25-,26+/m0/s1 |
| InChIKey | YWFHMSQVIJCONF-LIOHBJMPSA-N |
| XLogP | 5.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|