C26H42ClN3O — CID 24881607
5-(7-chloroquinolin-4-yl)oxy-N,N,N',N'-tetraethylnonane-1,9-diamine (PubChem CID 24881607) has the molecular formula C26H42ClN3O and a molecular weight of 448.10 g/mol. Its IUPAC name is 5-(7-chloroquinolin-4-yl)oxy-N,N,N',N'-tetraethylnonane-1,9-diamine.
| Compound Name | 5-(7-chloroquinolin-4-yl)oxy-N,N,N',N'-tetraethylnonane-1,9-diamine |
|---|---|
| PubChem CID | 24881607 |
| Molecular Formula | C26H42ClN3O |
| Molecular Weight | 448.10 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 5-(7-chloroquinolin-4-yl)oxy-N,N,N',N'-tetraethylnonane-1,9-diamine |
| SMILES | CCN(CC)CCCCC(CCCCN(CC)CC)Oc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H42ClN3O/c1-5-29(6-2)19-11-9-13-23(14-10-12-20-30(7-3)8-4)31-26-17-18-28-25-21-22(27)15-16-24(25)26/h15-18,21,23H,5-14,19-20H2,1-4H3 |
| InChIKey | PONQSXOUYWHUDO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.10 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|