C17H32O3Si — CID 24881632
1-[(2R,3S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-3-methyloxan-2-yl]propan-2-one (PubChem CID 24881632) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 1-[(2R,3S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-3-methyloxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,3S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-3-methyloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 24881632 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[(2R,3S,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-ethenyl-3-methyloxan-2-yl]propan-2-one |
| SMILES | C=C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CC(C)=O)O1 |
| InChI | InChI=1S/C17H32O3Si/c1-9-14-11-16(20-21(7,8)17(4,5)6)13(3)15(19-14)10-12(2)18/h9,13-16H,1,10-11H2,2-8H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | XGFUMLVEZDHZHD-CAOSSQGBSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|