About (3-phenylphenyl) N-octylcarbamate
(3-phenylphenyl) N-octylcarbamate (PubChem CID 24881672) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is (3-phenylphenyl) N-octylcarbamate.
Molecular Properties
| Compound Name | (3-phenylphenyl) N-octylcarbamate |
| PubChem CID | 24881672 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (3-phenylphenyl) N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H27NO2/c1-2-3-4-5-6-10-16-22-21(23)24-20-15-11-14-19(17-20)18-12-8-7-9-13-18/h7-9,11-15,17H,2-6,10,16H2,1H3,(H,22,23) |
| InChIKey | ZVIQRVAPSQCQGM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylphenyl) N-octylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylphenyl) N-octylcarbamate?
The IUPAC name of (3-phenylphenyl) N-octylcarbamate (CID 24881672) is (3-phenylphenyl) N-octylcarbamate.
What is the SMILES notation for (3-phenylphenyl) N-octylcarbamate?
The canonical SMILES for (3-phenylphenyl) N-octylcarbamate is CCCCCCCCNC(=O)Oc1cccc(-c2ccccc2)c1.
What is the InChIKey of (3-phenylphenyl) N-octylcarbamate?
The InChIKey is ZVIQRVAPSQCQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO2/c1-2-3-4-5-6-10-16-22-21(23)24-20-15-11-14-19(17-20)18-12-8-7-9-13-18/h7-9,11-15,17H,2-6,10,16H2,1H3,(H,22,23).
What are the key properties of (3-phenylphenyl) N-octylcarbamate?
(3-phenylphenyl) N-octylcarbamate has a molecular weight of 325.45 g/mol, XLogP of 5.80, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylphenyl) N-octylcarbamate is sourced from PubChem (CID 24881672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).