C22H24N2O5 — CID 24881762
tert-butyl (2R,4R)-2-hydroxy-4-(4-nitrophenyl)-6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 24881762) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-hydroxy-4-(4-nitrophenyl)-6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-hydroxy-4-(4-nitrophenyl)-6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 24881762 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | tert-butyl (2R,4R)-2-hydroxy-4-(4-nitrophenyl)-6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccccc2)=C[C@H](c2ccc([N+](=O)[O-])cc2)C[C@H]1O |
| InChI | InChI=1S/C22H24N2O5/c1-22(2,3)29-21(26)23-19(16-7-5-4-6-8-16)13-17(14-20(23)25)15-9-11-18(12-10-15)24(27)28/h4-13,17,20,25H,14H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | MJZPGLJBPQLNAQ-FXAWDEMLSA-N |
| XLogP | 4.68 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|