C13H22O2 — CID 24881905
2-[(1S,4R,5R,6S)-4,7,7-trimethyl-6-bicyclo[3.2.0]heptanyl]-1,3-dioxolane (PubChem CID 24881905) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-[(1S,4R,5R,6S)-4,7,7-trimethyl-6-bicyclo[3.2.0]heptanyl]-1,3-dioxolane.
| Compound Name | 2-[(1S,4R,5R,6S)-4,7,7-trimethyl-6-bicyclo[3.2.0]heptanyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 24881905 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-[(1S,4R,5R,6S)-4,7,7-trimethyl-6-bicyclo[3.2.0]heptanyl]-1,3-dioxolane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1[C@H](C1OCCO1)C2(C)C |
| InChI | InChI=1S/C13H22O2/c1-8-4-5-9-10(8)11(13(9,2)3)12-14-6-7-15-12/h8-12H,4-7H2,1-3H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | PAUUYMYSVZUNJI-LMLFDSFASA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |