About N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride (PubChem CID 24882010) has the molecular formula C11H14ClN5
and a molecular weight of 251.72 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride |
| PubChem CID | 24882010 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride |
| SMILES | Cc1cccc2c1cnn2NC1=NCCN1.Cl |
| InChI | InChI=1S/C11H13N5.ClH/c1-8-3-2-4-10-9(8)7-14-16(10)15-11-12-5-6-13-11;/h2-4,7H,5-6H2,1H3,(H2,12,13,15);1H |
| InChIKey | RIIKXDYNKVYPIX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride (CID 24882010) is N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride is Cc1cccc2c1cnn2NC1=NCCN1.Cl.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride?
The InChIKey is RIIKXDYNKVYPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5.ClH/c1-8-3-2-4-10-9(8)7-14-16(10)15-11-12-5-6-13-11;/h2-4,7H,5-6H2,1H3,(H2,12,13,15);1H.
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride?
N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride has a molecular weight of 251.72 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylindazol-1-amine;hydrochloride is sourced from PubChem (CID 24882010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).