C15H26N2O — CID 24882125
(6R,8S,9aS)-6-[(2S)-2-aminopent-4-enyl]-8-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 24882125) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (6R,8S,9aS)-6-[(2S)-2-aminopent-4-enyl]-8-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6R,8S,9aS)-6-[(2S)-2-aminopent-4-enyl]-8-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 24882125 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (6R,8S,9aS)-6-[(2S)-2-aminopent-4-enyl]-8-methyl-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | C=CC[C@H](N)C[C@H]1C[C@@H](C)C[C@@H]2CCCC(=O)N12 |
| InChI | InChI=1S/C15H26N2O/c1-3-5-12(16)10-14-9-11(2)8-13-6-4-7-15(18)17(13)14/h3,11-14H,1,4-10,16H2,2H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | ANHZKWQFYYLFIS-XDQVBPFNSA-N |
| XLogP | 2.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|