C16H16N2O3S — CID 24882129
N-[4-(2-phenylaziridin-1-yl)sulfonylphenyl]acetamide (PubChem CID 24882129) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[4-(2-phenylaziridin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | N-[4-(2-phenylaziridin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 24882129 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[4-(2-phenylaziridin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c1-12(19)17-14-7-9-15(10-8-14)22(20,21)18-11-16(18)13-5-3-2-4-6-13/h2-10,16H,11H2,1H3,(H,17,19) |
| InChIKey | IRPLMLOFICVHKE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|