C16H22O4 — CID 24882167
(6S,8S,9E,11aS)-8-methoxy-3,6,10-trimethyl-5,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,4-dione (PubChem CID 24882167) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (6S,8S,9E,11aS)-8-methoxy-3,6,10-trimethyl-5,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,4-dione.
| Compound Name | (6S,8S,9E,11aS)-8-methoxy-3,6,10-trimethyl-5,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,4-dione |
|---|---|
| PubChem CID | 24882167 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (6S,8S,9E,11aS)-8-methoxy-3,6,10-trimethyl-5,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,4-dione |
| SMILES | CO[C@@H]1/C=C(\C)C[C@@H]2OC(=O)C(C)=C2C(=O)C[C@@H](C)C1 |
| InChI | InChI=1S/C16H22O4/c1-9-5-12(19-4)6-10(2)8-14-15(13(17)7-9)11(3)16(18)20-14/h6,9,12,14H,5,7-8H2,1-4H3/b10-6+/t9-,12-,14-/m0/s1 |
| InChIKey | ZCTBPMFXNAWMSW-FCCWEZMDSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|