About 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole (PubChem CID 24882245) has the molecular formula C28H26N2S
and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole.
Molecular Properties
| Compound Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole |
| PubChem CID | 24882245 |
| Molecular Formula | C28H26N2S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole |
| SMILES | CCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H26N2S/c1-4-30-25-8-6-5-7-24(25)29-27(30)22-14-11-20(12-15-22)9-10-21-13-16-26-23(19-21)28(2,3)17-18-31-26/h5-8,11-16,19H,4,17-18H2,1-3H3 |
| InChIKey | PFKIPGUUUFXWRL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole?
The IUPAC name of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole (CID 24882245) is 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole.
What is the SMILES notation for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole?
The canonical SMILES for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole is CCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21.
What is the InChIKey of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole?
The InChIKey is PFKIPGUUUFXWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2S/c1-4-30-25-8-6-5-7-24(25)29-27(30)22-14-11-20(12-15-22)9-10-21-13-16-26-23(19-21)28(2,3)17-18-31-26/h5-8,11-16,19H,4,17-18H2,1-3H3.
What are the key properties of 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole?
2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole has a molecular weight of 422.60 g/mol, XLogP of 6.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]-1-ethylbenzimidazole is sourced from PubChem (CID 24882245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).