About 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole
1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole (PubChem CID 24882246) has the molecular formula C30H30N2S
and a molecular weight of 450.65 g/mol. Its IUPAC name is 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole.
Molecular Properties
| Compound Name | 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole |
| PubChem CID | 24882246 |
| Molecular Formula | C30H30N2S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole |
| SMILES | CCCCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21 |
| InChI | InChI=1S/C30H30N2S/c1-4-5-19-32-27-9-7-6-8-26(27)31-29(32)24-15-12-22(13-16-24)10-11-23-14-17-28-25(21-23)30(2,3)18-20-33-28/h6-9,12-17,21H,4-5,18-20H2,1-3H3 |
| InChIKey | LUZRQRXJENDANL-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole?
The IUPAC name of 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole (CID 24882246) is 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole.
What is the SMILES notation for 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole?
The canonical SMILES for 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole is CCCCn1c(-c2ccc(C#Cc3ccc4c(c3)C(C)(C)CCS4)cc2)nc2ccccc21.
What is the InChIKey of 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole?
The InChIKey is LUZRQRXJENDANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30N2S/c1-4-5-19-32-27-9-7-6-8-26(27)31-29(32)24-15-12-22(13-16-24)10-11-23-14-17-28-25(21-23)30(2,3)18-20-33-28/h6-9,12-17,21H,4-5,18-20H2,1-3H3.
What are the key properties of 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole?
1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole has a molecular weight of 450.65 g/mol, XLogP of 7.68, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-[4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]benzimidazole is sourced from PubChem (CID 24882246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).