C19H23NOS — CID 24882444
5-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]-3H-1,3-benzoxazole-2-thione (PubChem CID 24882444) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 5-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]-3H-1,3-benzoxazole-2-thione.
| Compound Name | 5-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]-3H-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 24882444 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]-3H-1,3-benzoxazole-2-thione |
| SMILES | C=C[C@@](C)(/C=C/c1ccc2oc(=S)[nH]c2c1)CCC=C(C)C |
| InChI | InChI=1S/C19H23NOS/c1-5-19(4,11-6-7-14(2)3)12-10-15-8-9-17-16(13-15)20-18(22)21-17/h5,7-10,12-13H,1,6,11H2,2-4H3,(H,20,22)/b12-10+/t19-/m1/s1 |
| InChIKey | LETZYEBTUXZPJB-FMAYLGMYSA-N |
| XLogP | 6.44 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|