About 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea
1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea (PubChem CID 24882503) has the molecular formula C23H26Cl2N6O2
and a molecular weight of 489.41 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea.
Molecular Properties
| Compound Name | 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea |
| PubChem CID | 24882503 |
| Molecular Formula | C23H26Cl2N6O2 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea |
| SMILES | CCN(CC)CCOc1ccc(Nc2cc(NC(=O)Nc3c(Cl)cccc3Cl)ncn2)cc1 |
| InChI | InChI=1S/C23H26Cl2N6O2/c1-3-31(4-2)12-13-33-17-10-8-16(9-11-17)28-20-14-21(27-15-26-20)29-23(32)30-22-18(24)6-5-7-19(22)25/h5-11,14-15H,3-4,12-13H2,1-2H3,(H3,26,27,28,29,30,32) |
| InChIKey | FOMAIMPXVLHOCI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea?
The IUPAC name of 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea (CID 24882503) is 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea.
What is the SMILES notation for 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea?
The canonical SMILES for 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea is CCN(CC)CCOc1ccc(Nc2cc(NC(=O)Nc3c(Cl)cccc3Cl)ncn2)cc1.
What is the InChIKey of 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea?
The InChIKey is FOMAIMPXVLHOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N6O2/c1-3-31(4-2)12-13-33-17-10-8-16(9-11-17)28-20-14-21(27-15-26-20)29-23(32)30-22-18(24)6-5-7-19(22)25/h5-11,14-15H,3-4,12-13H2,1-2H3,(H3,26,27,28,29,30,32).
What are the key properties of 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea?
1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea has a molecular weight of 489.41 g/mol, XLogP of 5.89, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichlorophenyl)-3-[6-[4-[2-(diethylamino)ethoxy]anilino]pyrimidin-4-yl]urea is sourced from PubChem (CID 24882503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).