About 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole
5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 24882538) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole |
| PubChem CID | 24882538 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Cc1ccc(C2CC(c3ccc(-c4ccccc4)cc3)=NN2)cc1 |
| InChI | InChI=1S/C22H20N2/c1-16-7-9-19(10-8-16)21-15-22(24-23-21)20-13-11-18(12-14-20)17-5-3-2-4-6-17/h2-14,21,23H,15H2,1H3 |
| InChIKey | PMLZZDFKZFUXGL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole (CID 24882538) is 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole is Cc1ccc(C2CC(c3ccc(-c4ccccc4)cc3)=NN2)cc1.
What is the InChIKey of 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole?
The InChIKey is PMLZZDFKZFUXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2/c1-16-7-9-19(10-8-16)21-15-22(24-23-21)20-13-11-18(12-14-20)17-5-3-2-4-6-17/h2-14,21,23H,15H2,1H3.
What are the key properties of 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole?
5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole has a molecular weight of 312.42 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)-3-(4-phenylphenyl)-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 24882538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).