C22H21F3N2O3 — CID 24882612
N-[(6-hydroxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 24882612) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[(6-hydroxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(6-hydroxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24882612 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[(6-hydroxy-9-methyl-1,2,3,4-tetrahydrocarbazol-4-yl)methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cn1c2c(c3cc(O)ccc31)C(CNC(=O)c1ccc(OC(F)(F)F)cc1)CCC2 |
| InChI | InChI=1S/C22H21F3N2O3/c1-27-18-10-7-15(28)11-17(18)20-14(3-2-4-19(20)27)12-26-21(29)13-5-8-16(9-6-13)30-22(23,24)25/h5-11,14,28H,2-4,12H2,1H3,(H,26,29) |
| InChIKey | UMHVOYZISKMPIT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|