C20H30O7 — CID 24882704
(3aR,5aS,8S,9aR,9bR)-4-[(E)-hept-1-enyl]-8,9a-dihydroxy-5-(hydroxymethyl)-7,7-dimethyl-5a,8,9,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-f]chromen-2-one (PubChem CID 24882704) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (3aR,5aS,8S,9aR,9bR)-4-[(E)-hept-1-enyl]-8,9a-dihydroxy-5-(hydroxymethyl)-7,7-dimethyl-5a,8,9,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-f]chromen-2-one.
| Compound Name | (3aR,5aS,8S,9aR,9bR)-4-[(E)-hept-1-enyl]-8,9a-dihydroxy-5-(hydroxymethyl)-7,7-dimethyl-5a,8,9,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-f]chromen-2-one |
|---|---|
| PubChem CID | 24882704 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3aR,5aS,8S,9aR,9bR)-4-[(E)-hept-1-enyl]-8,9a-dihydroxy-5-(hydroxymethyl)-7,7-dimethyl-5a,8,9,9b-tetrahydro-3aH-[1,3]dioxolo[4,5-f]chromen-2-one |
| SMILES | CCCCC/C=C/C1=C(CO)[C@@H]2OC(C)(C)[C@@H](O)C[C@]2(O)[C@@H]2OC(=O)O[C@H]12 |
| InChI | InChI=1S/C20H30O7/c1-4-5-6-7-8-9-12-13(11-21)16-20(24,10-14(22)19(2,3)27-16)17-15(12)25-18(23)26-17/h8-9,14-17,21-22,24H,4-7,10-11H2,1-3H3/b9-8+/t14-,15+,16-,17+,20+/m0/s1 |
| InChIKey | IMQYAWIJNZPDJB-QKWWGZASSA-N |
| XLogP | 1.99 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|