C22H19Cl2F3N6S — CID 24882754
2-N-(2,6-dichlorophenyl)-5-N-(2-methylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine (PubChem CID 24882754) has the molecular formula C22H19Cl2F3N6S and a molecular weight of 527.40 g/mol. Its IUPAC name is 2-N-(2,6-dichlorophenyl)-5-N-(2-methylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine.
| Compound Name | 2-N-(2,6-dichlorophenyl)-5-N-(2-methylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
|---|---|
| PubChem CID | 24882754 |
| Molecular Formula | C22H19Cl2F3N6S |
| Molecular Weight | 527.40 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 2-N-(2,6-dichlorophenyl)-5-N-(2-methylpropyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
| SMILES | CC(C)CNc1nc(Nc2ccc(C(F)(F)F)cc2)c2nc(Nc3c(Cl)cccc3Cl)sc2n1 |
| InChI | InChI=1S/C22H19Cl2F3N6S/c1-11(2)10-28-20-32-18(29-13-8-6-12(7-9-13)22(25,26)27)17-19(33-20)34-21(31-17)30-16-14(23)4-3-5-15(16)24/h3-9,11H,10H2,1-2H3,(H,30,31)(H2,28,29,32,33) |
| InChIKey | KXBDRWINDHCJDI-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.40 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |