C41H38NOP — CID 24882935
(1R,2S)-2-(dibenzylamino)-1-(2-diphenylphosphanylphenyl)-3-phenylpropan-1-ol (PubChem CID 24882935) has the molecular formula C41H38NOP and a molecular weight of 591.74 g/mol. Its IUPAC name is (1R,2S)-2-(dibenzylamino)-1-(2-diphenylphosphanylphenyl)-3-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(dibenzylamino)-1-(2-diphenylphosphanylphenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 24882935 |
| Molecular Formula | C41H38NOP |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | (1R,2S)-2-(dibenzylamino)-1-(2-diphenylphosphanylphenyl)-3-phenylpropan-1-ol |
| SMILES | O[C@H](c1ccccc1P(c1ccccc1)c1ccccc1)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C41H38NOP/c43-41(38-28-16-17-29-40(38)44(36-24-12-4-13-25-36)37-26-14-5-15-27-37)39(30-33-18-6-1-7-19-33)42(31-34-20-8-2-9-21-34)32-35-22-10-3-11-23-35/h1-29,39,41,43H,30-32H2/t39-,41+/m0/s1 |
| InChIKey | OZKLZZBNAQUVIN-VAASOWBASA-N |
| XLogP | 7.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|