C28H38N6O6S2 — CID 24883233
(2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]-4-methylsulfanylbutanamide (PubChem CID 24883233) has the molecular formula C28H38N6O6S2 and a molecular weight of 618.78 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24883233 |
| Molecular Formula | C28H38N6O6S2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCCNc1ccc(NCCNC(=O)[C@@H](N)CCSC)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C28H38N6O6S2/c1-41-13-7-15(29)27(39)33-11-9-31-17-3-4-18(32-10-12-34-28(40)16(30)8-14-42-2)22-21(17)25(37)23-19(35)5-6-20(36)24(23)26(22)38/h3-6,15-16,31-32,35-36H,7-14,29-30H2,1-2H3,(H,33,39)(H,34,40)/t15-,16-/m0/s1 |
| InChIKey | ZCXAWHROKRWMPY-HOTGVXAUSA-N |
| XLogP | 1.09 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|