C19H28N2O5 — CID 24883286
4-O-tert-butyl 13-O-ethyl (3S,7R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate (PubChem CID 24883286) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-O-tert-butyl 13-O-ethyl (3S,7R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate.
| Compound Name | 4-O-tert-butyl 13-O-ethyl (3S,7R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate |
|---|---|
| PubChem CID | 24883286 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-O-tert-butyl 13-O-ethyl (3S,7R,13S)-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4,13-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC2C=C[C@H]3CCN(C(=O)OC(C)(C)C)[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C19H28N2O5/c1-5-25-17(23)14-9-8-13-7-6-12-10-11-20(15(12)16(22)21(13)14)18(24)26-19(2,3)4/h6-7,12-15H,5,8-11H2,1-4H3/t12-,13?,14-,15-/m0/s1 |
| InChIKey | UNHZCZDKYOYYFP-AKRBKJBTSA-N |
| XLogP | 2.10 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|