C22H17Cl2F3N6S — CID 24883353
5-N-(cyclopropylmethyl)-2-N-(2,6-dichlorophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine (PubChem CID 24883353) has the molecular formula C22H17Cl2F3N6S and a molecular weight of 525.39 g/mol. Its IUPAC name is 5-N-(cyclopropylmethyl)-2-N-(2,6-dichlorophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine.
| Compound Name | 5-N-(cyclopropylmethyl)-2-N-(2,6-dichlorophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
|---|---|
| PubChem CID | 24883353 |
| Molecular Formula | C22H17Cl2F3N6S |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 5-N-(cyclopropylmethyl)-2-N-(2,6-dichlorophenyl)-7-N-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[5,4-d]pyrimidine-2,5,7-triamine |
| SMILES | FC(F)(F)c1ccc(Nc2nc(NCC3CC3)nc3sc(Nc4c(Cl)cccc4Cl)nc23)cc1 |
| InChI | InChI=1S/C22H17Cl2F3N6S/c23-14-2-1-3-15(24)16(14)30-21-31-17-18(29-13-8-6-12(7-9-13)22(25,26)27)32-20(33-19(17)34-21)28-10-11-4-5-11/h1-3,6-9,11H,4-5,10H2,(H,30,31)(H2,28,29,32,33) |
| InChIKey | PJCDQGSJFWIYNX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |