About 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron
2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron (PubChem CID 24883453) has the molecular formula C6H13NO6S
and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron.
Molecular Properties
| Compound Name | 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron |
| PubChem CID | 24883453 |
| Molecular Formula | C6H13NO6S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron |
| SMILES | NCCS.O=C([O-])C(O)C(O)C(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C4H6O6.C2H7NS/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2 |
| InChIKey | NSKJTUFFDRENDM-UHFFFAOYSA-N |
| XLogP | -4.69 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron?
The IUPAC name of 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron (CID 24883453) is 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron.
What is the SMILES notation for 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron?
The canonical SMILES for 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron is NCCS.O=C([O-])C(O)C(O)C(=O)[O-].[H+].[H+].
What is the InChIKey of 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron?
The InChIKey is NSKJTUFFDRENDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O6.C2H7NS/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2.
What are the key properties of 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron?
2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron has a molecular weight of 227.24 g/mol, XLogP of -4.69, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanethiol;2,3-dihydroxybutanedioate;hydron is sourced from PubChem (CID 24883453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).