C20H14Fe2-8 — CID 24883653
bis(cyclopenta-1,3-diene);5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;iron (PubChem CID 24883653) has the molecular formula C20H14Fe2-8 and a molecular weight of 366.02 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;iron.
| Compound Name | bis(cyclopenta-1,3-diene);5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;iron |
|---|---|
| PubChem CID | 24883653 |
| Molecular Formula | C20H14Fe2-8 |
| Molecular Weight | 366.02 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | bis(cyclopenta-1,3-diene);5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;iron |
| SMILES | [Fe].[Fe].[c-]1[c-][c-][c-](-[c-]2cccc2)[c-]1.c1cc[cH-]c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C10H4.2C5H5.2Fe/c1-2-6-9(5-1)10-7-3-4-8-10;2*1-2-4-5-3-1;;/h1-2,5-6H;2*1-5H;;/q-6;2*-1;; |
| InChIKey | OBPUHBYZTXTZIK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.02 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|