C21H29IN2O2 — CID 24883890
(9R,10S,13S,14R,16S)-13-ethyl-8,15-dimethyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol iodide (PubChem CID 24883890) has the molecular formula C21H29IN2O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is (9R,10S,13S,14R,16S)-13-ethyl-8,15-dimethyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol iodide.
| Compound Name | (9R,10S,13S,14R,16S)-13-ethyl-8,15-dimethyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol iodide |
|---|---|
| PubChem CID | 24883890 |
| Molecular Formula | C21H29IN2O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (9R,10S,13S,14R,16S)-13-ethyl-8,15-dimethyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol iodide |
| SMILES | CC[C@H]1C2C[C@H]3[C@@H]4N(C)c5ccccc5C45C[C@@H](C2C5O)[N+]3(C)[C@@H]1O.[I-] |
| InChI | InChI=1S/C21H29N2O2.HI/c1-4-11-12-9-15-18-21(13-7-5-6-8-14(13)22(18)2)10-16(17(12)19(21)24)23(15,3)20(11)25;/h5-8,11-12,15-20,24-25H,4,9-10H2,1-3H3;1H/q+1;/p-1/t11-,12?,15-,16-,17?,18-,19?,20+,21?,23?;/m0./s1 |
| InChIKey | DVXCPMVDGCXNBF-QNICHJOWSA-M |
| XLogP | -1.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|