About (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate
(2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 2488438) has the molecular formula C13H13NO5
and a molecular weight of 263.25 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate.
Molecular Properties
| Compound Name | (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate |
| PubChem CID | 2488438 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | O=C(COC(=O)C1=COCCO1)Nc1ccccc1 |
| InChI | InChI=1S/C13H13NO5/c15-12(14-10-4-2-1-3-5-10)9-19-13(16)11-8-17-6-7-18-11/h1-5,8H,6-7,9H2,(H,14,15) |
| InChIKey | FKKSCLRGPYIBNU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate?
The IUPAC name of (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate (CID 2488438) is (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate.
What is the SMILES notation for (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate?
The canonical SMILES for (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate is O=C(COC(=O)C1=COCCO1)Nc1ccccc1.
What is the InChIKey of (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate?
The InChIKey is FKKSCLRGPYIBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c15-12(14-10-4-2-1-3-5-10)9-19-13(16)11-8-17-6-7-18-11/h1-5,8H,6-7,9H2,(H,14,15).
What are the key properties of (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate?
(2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate has a molecular weight of 263.25 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-2-oxoethyl) 2,3-dihydro-1,4-dioxine-5-carboxylate is sourced from PubChem (CID 2488438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).