About 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide
1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 24884526) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
Analyze 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide?
The IUPAC name of 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide (CID 24884526) is 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
What is the SMILES notation for 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide?
The canonical SMILES for 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide is CC1(C)C(C)(C)C1(F)C(N)=O.
What is the InChIKey of 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide?
The InChIKey is YGMATHWCLCKFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FNO/c1-6(2)7(3,4)8(6,9)5(10)11/h1-4H3,(H2,10,11).
What are the key properties of 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide?
1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide has a molecular weight of 159.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,2,3,3-tetramethylcyclopropane-1-carboxamide is sourced from PubChem (CID 24884526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).