C29H34N2O2 — CID 24884714
5-cyclobutyl-5-hydroxy-2-[3-[(6-methylnaphthalen-2-yl)methylamino]propyl]-1,3-dihydro-2-benzazepin-4-one (PubChem CID 24884714) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 5-cyclobutyl-5-hydroxy-2-[3-[(6-methylnaphthalen-2-yl)methylamino]propyl]-1,3-dihydro-2-benzazepin-4-one.
| Compound Name | 5-cyclobutyl-5-hydroxy-2-[3-[(6-methylnaphthalen-2-yl)methylamino]propyl]-1,3-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 24884714 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 5-cyclobutyl-5-hydroxy-2-[3-[(6-methylnaphthalen-2-yl)methylamino]propyl]-1,3-dihydro-2-benzazepin-4-one |
| SMILES | Cc1ccc2cc(CNCCCN3CC(=O)C(O)(C4CCC4)c4ccccc4C3)ccc2c1 |
| InChI | InChI=1S/C29H34N2O2/c1-21-10-12-24-17-22(11-13-23(24)16-21)18-30-14-5-15-31-19-25-6-2-3-9-27(25)29(33,28(32)20-31)26-7-4-8-26/h2-3,6,9-13,16-17,26,30,33H,4-5,7-8,14-15,18-20H2,1H3 |
| InChIKey | KMPQNQHZYPVSNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|