C18H38O3Si — CID 24884890
(2S,3S,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-8-ene-1,3-diol (PubChem CID 24884890) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is (2S,3S,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-8-ene-1,3-diol.
| Compound Name | (2S,3S,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-8-ene-1,3-diol |
|---|---|
| PubChem CID | 24884890 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (2S,3S,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylnon-8-ene-1,3-diol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](C)[C@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C18H38O3Si/c1-10-16(21-22(8,9)18(5,6)7)13(2)11-14(3)17(20)15(4)12-19/h10,13-17,19-20H,1,11-12H2,2-9H3/t13-,14+,15+,16-,17+/m1/s1 |
| InChIKey | NCYWWZRWORIHFC-HMDCTGQHSA-N |
| XLogP | 4.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|